C25H45ClF3N7O — CID 155150851
3,3-diamino-2-(10-chloro-8-azaspiro[5.6]dodecan-7-yl)-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 155150851) has the molecular formula C25H45ClF3N7O and a molecular weight of 552.13 g/mol. Its IUPAC name is 3,3-diamino-2-(10-chloro-8-azaspiro[5.6]dodecan-7-yl)-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(10-chloro-8-azaspiro[5.6]dodecan-7-yl)-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150851 |
| Molecular Formula | C25H45ClF3N7O |
| Molecular Weight | 552.13 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | 3,3-diamino-2-(10-chloro-8-azaspiro[5.6]dodecan-7-yl)-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | NC(N)C(C(=O)NC1CNCCC1N1CCN(CC(F)(F)F)CC1)C1NCC(Cl)CCC12CCCCC2 |
| InChI | InChI=1S/C25H45ClF3N7O/c26-17-4-8-24(6-2-1-3-7-24)21(33-14-17)20(22(30)31)23(37)34-18-15-32-9-5-19(18)36-12-10-35(11-13-36)16-25(27,28)29/h17-22,32-33H,1-16,30-31H2,(H,34,37) |
| InChIKey | WQVCOTHCKBTITM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.13 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|