C29H54FN7O2 — CID 155150886
2-carbamimidoyl-3-[[(Z)-5-ethyl-2-fluoronon-3-enyl]amino]-N-[4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]piperidin-3-yl]butanamide (PubChem CID 155150886) has the molecular formula C29H54FN7O2 and a molecular weight of 551.80 g/mol. Its IUPAC name is 2-carbamimidoyl-3-[[(Z)-5-ethyl-2-fluoronon-3-enyl]amino]-N-[4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]piperidin-3-yl]butanamide.
| Compound Name | 2-carbamimidoyl-3-[[(Z)-5-ethyl-2-fluoronon-3-enyl]amino]-N-[4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 155150886 |
| Molecular Formula | C29H54FN7O2 |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.43 |
| IUPAC Name | 2-carbamimidoyl-3-[[(Z)-5-ethyl-2-fluoronon-3-enyl]amino]-N-[4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]piperidin-3-yl]butanamide |
| SMILES | [H]/N=C(\N)C(C(=O)NC1CNCCC1N1CCN([C@H]2CCOC2)CC1)C(C)NCC(F)/C=C\C(CC)CCCC |
| InChI | InChI=1S/C29H54FN7O2/c1-4-6-7-22(5-2)8-9-23(30)18-34-21(3)27(28(31)32)29(38)35-25-19-33-12-10-26(25)37-15-13-36(14-16-37)24-11-17-39-20-24/h8-9,21-27,33-34H,4-7,10-20H2,1-3H3,(H3,31,32)(H,35,38)/b9-8-/t21?,22?,23?,24-,25?,26?,27?/m0/s1 |
| InChIKey | ASXJMLPHFINXKE-YMJZXYSISA-N |
| XLogP | 1.88 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|