C27H51FN8O2 — CID 155150889
3,3-diamino-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)-N-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]propanamide (PubChem CID 155150889) has the molecular formula C27H51FN8O2 and a molecular weight of 538.76 g/mol. Its IUPAC name is 3,3-diamino-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)-N-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)-N-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150889 |
| Molecular Formula | C27H51FN8O2 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | 3,3-diamino-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)-N-[4-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCCCCN1CC(F)CNC1C(C(=O)NC1CNCCC1N1CCC(C(=O)N2CCCC2)CC1)C(N)N |
| InChI | InChI=1S/C27H51FN8O2/c1-2-3-4-13-36-18-20(28)16-32-25(36)23(24(29)30)26(37)33-21-17-31-10-7-22(21)34-14-8-19(9-15-34)27(38)35-11-5-6-12-35/h19-25,31-32H,2-18,29-30H2,1H3,(H,33,37) |
| InChIKey | HOSCCGFNEPFZJC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|