C25H44N6O3 — CID 155150957
3,3-diamino-2-[3-(cyanomethyl)-6,6-dimethyl-2-propan-2-yl-3,4,5,7-tetrahydro-2H-azocin-8-yl]-N-[4-(oxetan-3-yloxy)piperidin-3-yl]propanamide (PubChem CID 155150957) has the molecular formula C25H44N6O3 and a molecular weight of 476.67 g/mol. Its IUPAC name is 3,3-diamino-2-[3-(cyanomethyl)-6,6-dimethyl-2-propan-2-yl-3,4,5,7-tetrahydro-2H-azocin-8-yl]-N-[4-(oxetan-3-yloxy)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[3-(cyanomethyl)-6,6-dimethyl-2-propan-2-yl-3,4,5,7-tetrahydro-2H-azocin-8-yl]-N-[4-(oxetan-3-yloxy)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150957 |
| Molecular Formula | C25H44N6O3 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | 3,3-diamino-2-[3-(cyanomethyl)-6,6-dimethyl-2-propan-2-yl-3,4,5,7-tetrahydro-2H-azocin-8-yl]-N-[4-(oxetan-3-yloxy)piperidin-3-yl]propanamide |
| SMILES | CC(C)C1/N=C(/C(C(=O)NC2CNCCC2OC2COC2)C(N)N)CC(C)(C)CCC1CC#N |
| InChI | InChI=1S/C25H44N6O3/c1-15(2)22-16(6-9-26)5-8-25(3,4)11-18(30-22)21(23(27)28)24(32)31-19-12-29-10-7-20(19)34-17-13-33-14-17/h15-17,19-23,29H,5-8,10-14,27-28H2,1-4H3,(H,31,32)/b30-18+ |
| InChIKey | CSKMGVCWEPPLSG-UXHLAJHPSA-N |
| XLogP | 1.31 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|