C44H62F2N2O4 — CID 155151043
bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 2,2,6,6-tetramethyloctanedioate (PubChem CID 155151043) has the molecular formula C44H62F2N2O4 and a molecular weight of 720.99 g/mol. Its IUPAC name is bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 2,2,6,6-tetramethyloctanedioate.
| Compound Name | bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 2,2,6,6-tetramethyloctanedioate |
|---|---|
| PubChem CID | 155151043 |
| Molecular Formula | C44H62F2N2O4 |
| Molecular Weight | 720.99 g/mol |
| Exact Mass | 720.47 |
| IUPAC Name | bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 2,2,6,6-tetramethyloctanedioate |
| SMILES | CC(C)(CCCC(C)(C)C(=O)Oc1cc(F)c2c(c1)[C@@]1(C)CCCCC[C@@H](C2)[C@@H]1N)CC(=O)Oc1cc(F)c2c(c1)[C@@]1(C)CCCCC[C@@H](C2)C1N |
| InChI | InChI=1S/C44H62F2N2O4/c1-41(2,26-37(49)51-29-22-33-31(35(45)24-29)20-27-14-9-7-11-18-43(33,5)38(27)47)16-13-17-42(3,4)40(50)52-30-23-34-32(36(46)25-30)21-28-15-10-8-12-19-44(34,6)39(28)48/h22-25,27-28,38-39H,7-21,26,47-48H2,1-6H3/t27-,28-,38?,39-,43+,44+/m0/s1 |
| InChIKey | BQUOOULCUMXPJT-GHYPSZEJSA-N |
| XLogP | 9.53 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.99 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|