C22H39NO2 — CID 155151158
(5E)-5-ethyl-4-[[(Z)-5-methoxy-2,6-dimethylhept-4-en-3-yl]oxymethyl]-6-methylocta-1,5,7-trien-3-amine (PubChem CID 155151158) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (5E)-5-ethyl-4-[[(Z)-5-methoxy-2,6-dimethylhept-4-en-3-yl]oxymethyl]-6-methylocta-1,5,7-trien-3-amine.
| Compound Name | (5E)-5-ethyl-4-[[(Z)-5-methoxy-2,6-dimethylhept-4-en-3-yl]oxymethyl]-6-methylocta-1,5,7-trien-3-amine |
|---|---|
| PubChem CID | 155151158 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (5E)-5-ethyl-4-[[(Z)-5-methoxy-2,6-dimethylhept-4-en-3-yl]oxymethyl]-6-methylocta-1,5,7-trien-3-amine |
| SMILES | C=C/C(C)=C(\CC)C(COC(/C=C(\OC)C(C)C)C(C)C)C(N)C=C |
| InChI | InChI=1S/C22H39NO2/c1-10-17(8)18(11-2)19(20(23)12-3)14-25-22(16(6)7)13-21(24-9)15(4)5/h10,12-13,15-16,19-20,22H,1,3,11,14,23H2,2,4-9H3/b18-17+,21-13- |
| InChIKey | DQVLZXROYHDRJQ-VZZOEOTCSA-N |
| XLogP | 5.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|