C22H17F3N8OS — CID 155151754
N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridine-1-carboxamide (PubChem CID 155151754) has the molecular formula C22H17F3N8OS and a molecular weight of 498.49 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridine-1-carboxamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridine-1-carboxamide |
|---|---|
| PubChem CID | 155151754 |
| Molecular Formula | C22H17F3N8OS |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-8,9,10,11-tetrahydro-3H-pyrazolo[4,3-a]phenanthridine-1-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2n[nH]c3ccc4nc(-c5cn[nH]c5C(F)(F)F)c5c(c4c23)CCCC5)s1 |
| InChI | InChI=1S/C22H17F3N8OS/c1-9-29-33-21(35-9)28-20(34)18-16-14(30-31-18)7-6-13-15(16)10-4-2-3-5-11(10)17(27-13)12-8-26-32-19(12)22(23,24)25/h6-8H,2-5H2,1H3,(H,26,32)(H,30,31)(H,28,33,34) |
| InChIKey | CZXPALDQPNSYTO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |