About 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol
3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol (PubChem CID 155151882) has the molecular formula C21H20FN3O
and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol.
Molecular Properties
| Compound Name | 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol |
| PubChem CID | 155151882 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol |
| SMILES | Cc1c(CC(C)C)c(-c2ccc(O)cc2F)nc2ccc3[nH]ncc3c12 |
| InChI | InChI=1S/C21H20FN3O/c1-11(2)8-15-12(3)20-16-10-23-25-18(16)6-7-19(20)24-21(15)14-5-4-13(26)9-17(14)22/h4-7,9-11,26H,8H2,1-3H3,(H,23,25) |
| InChIKey | IGHAQBOQUYVJJP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The IUPAC name of 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol (CID 155151882) is 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol.
What is the SMILES notation for 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The canonical SMILES for 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol is Cc1c(CC(C)C)c(-c2ccc(O)cc2F)nc2ccc3[nH]ncc3c12.
What is the InChIKey of 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
The InChIKey is IGHAQBOQUYVJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O/c1-11(2)8-15-12(3)20-16-10-23-25-18(16)6-7-19(20)24-21(15)14-5-4-13(26)9-17(14)22/h4-7,9-11,26H,8H2,1-3H3,(H,23,25).
What are the key properties of 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol?
3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol has a molecular weight of 349.41 g/mol, XLogP of 5.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[9-methyl-8-(2-methylpropyl)-3H-pyrazolo[4,5-f]quinolin-7-yl]phenol is sourced from PubChem (CID 155151882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).