C18H20F4O2 — CID 15515189
(2,3,5,6-tetrafluoro-4-methylphenyl)methyl (1R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 15515189) has the molecular formula C18H20F4O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methylphenyl)methyl (1R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | (2,3,5,6-tetrafluoro-4-methylphenyl)methyl (1R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 15515189 |
| Molecular Formula | C18H20F4O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methylphenyl)methyl (1R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)=CC1[C@@H](C(=O)OCc2c(F)c(F)c(C)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H20F4O2/c1-8(2)6-11-12(18(11,4)5)17(23)24-7-10-15(21)13(19)9(3)14(20)16(10)22/h6,11-12H,7H2,1-5H3/t11?,12-/m0/s1 |
| InChIKey | WPLLLTXDXYETNV-KIYNQFGBSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|