About 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol
2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol (PubChem CID 155151980) has the molecular formula C20H17F2N3O
and a molecular weight of 353.37 g/mol. Its IUPAC name is 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol.
Molecular Properties
| Compound Name | 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol |
| PubChem CID | 155151980 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol |
| SMILES | CCCc1c(-c2ccc(O)c(F)c2F)nc2ccc3[nH]ncc3c2c1C |
| InChI | InChI=1S/C20H17F2N3O/c1-3-4-11-10(2)17-13-9-23-25-14(13)6-7-15(17)24-20(11)12-5-8-16(26)19(22)18(12)21/h5-9,26H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | RCAPRZGGWMFSQD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol?
The IUPAC name of 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol (CID 155151980) is 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol.
What is the SMILES notation for 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol?
The canonical SMILES for 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol is CCCc1c(-c2ccc(O)c(F)c2F)nc2ccc3[nH]ncc3c2c1C.
What is the InChIKey of 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol?
The InChIKey is RCAPRZGGWMFSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O/c1-3-4-11-10(2)17-13-9-23-25-14(13)6-7-15(17)24-20(11)12-5-8-16(26)19(22)18(12)21/h5-9,26H,3-4H2,1-2H3,(H,23,25).
What are the key properties of 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol?
2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol has a molecular weight of 353.37 g/mol, XLogP of 5.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-4-(9-methyl-8-propyl-3H-pyrazolo[4,5-f]quinolin-7-yl)phenol is sourced from PubChem (CID 155151980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).