C19H20N4O — CID 155151982
1-(cyclohexen-1-yl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-indazol-5-yl)methanimine (PubChem CID 155151982) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-indazol-5-yl)methanimine.
| Compound Name | 1-(cyclohexen-1-yl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-indazol-5-yl)methanimine |
|---|---|
| PubChem CID | 155151982 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-indazol-5-yl)methanimine |
| SMILES | Cc1noc(C)c1/C(=N/c1ccc2[nH]ncc2c1)C1=CCCCC1 |
| InChI | InChI=1S/C19H20N4O/c1-12-18(13(2)24-23-12)19(14-6-4-3-5-7-14)21-16-8-9-17-15(10-16)11-20-22-17/h6,8-11H,3-5,7H2,1-2H3,(H,20,22)/b21-19+ |
| InChIKey | XXAYLAWNQDXCLR-XUTLUUPISA-N |
| XLogP | 4.79 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|