C10H14NO3P — CID 155152100
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(phosphanylamino)ethanol (PubChem CID 155152100) has the molecular formula C10H14NO3P and a molecular weight of 227.20 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(phosphanylamino)ethanol.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(phosphanylamino)ethanol |
|---|---|
| PubChem CID | 155152100 |
| Molecular Formula | C10H14NO3P |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(phosphanylamino)ethanol |
| SMILES | OC(CNP)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H14NO3P/c12-8(6-11-15)7-1-2-9-10(5-7)14-4-3-13-9/h1-2,5,8,11-12H,3-4,6,15H2 |
| InChIKey | QXVQFUWRDUATRZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|