C13H21NO3 — CID 155152173
3-(3-ethoxyoxiran-2-yl)-2-methyl-2,3,5,6,7,7a-hexahydro-1H-indol-5-ol (PubChem CID 155152173) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(3-ethoxyoxiran-2-yl)-2-methyl-2,3,5,6,7,7a-hexahydro-1H-indol-5-ol.
| Compound Name | 3-(3-ethoxyoxiran-2-yl)-2-methyl-2,3,5,6,7,7a-hexahydro-1H-indol-5-ol |
|---|---|
| PubChem CID | 155152173 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(3-ethoxyoxiran-2-yl)-2-methyl-2,3,5,6,7,7a-hexahydro-1H-indol-5-ol |
| SMILES | CCOC1OC1C1C2=CC(O)CCC2NC1C |
| InChI | InChI=1S/C13H21NO3/c1-3-16-13-12(17-13)11-7(2)14-10-5-4-8(15)6-9(10)11/h6-8,10-15H,3-5H2,1-2H3 |
| InChIKey | UDYKYBZAEMKLNQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|