About 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide
1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide (PubChem CID 155153118) has the molecular formula C13H14FN3O2
and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide |
| PubChem CID | 155153118 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide |
| SMILES | CCn1cc(C(=O)NC2=NC(F)CC=C2)ccc1=O |
| InChI | InChI=1S/C13H14FN3O2/c1-2-17-8-9(6-7-12(17)18)13(19)16-11-5-3-4-10(14)15-11/h3,5-8,10H,2,4H2,1H3,(H,15,16,19) |
| InChIKey | NJGYEYACINBLEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide?
The IUPAC name of 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide (CID 155153118) is 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide.
What is the SMILES notation for 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide?
The canonical SMILES for 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide is CCn1cc(C(=O)NC2=NC(F)CC=C2)ccc1=O.
What is the InChIKey of 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide?
The InChIKey is NJGYEYACINBLEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O2/c1-2-17-8-9(6-7-12(17)18)13(19)16-11-5-3-4-10(14)15-11/h3,5-8,10H,2,4H2,1H3,(H,15,16,19).
What are the key properties of 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide?
1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide has a molecular weight of 263.27 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(2-fluoro-2,3-dihydropyridin-6-yl)-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 155153118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).