C16H21N7O2 — CID 155153444
17-(methylamino)-2,7,11,15,16,19-hexazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),13(20),14,17-tetraene-6,12-dione (PubChem CID 155153444) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 17-(methylamino)-2,7,11,15,16,19-hexazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),13(20),14,17-tetraene-6,12-dione.
| Compound Name | 17-(methylamino)-2,7,11,15,16,19-hexazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),13(20),14,17-tetraene-6,12-dione |
|---|---|
| PubChem CID | 155153444 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 17-(methylamino)-2,7,11,15,16,19-hexazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),13(20),14,17-tetraene-6,12-dione |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NCCCN1CC(CCC1=O)N2 |
| InChI | InChI=1S/C16H21N7O2/c1-17-13-7-12-20-10-3-4-14(24)22(9-10)6-2-5-18-16(25)11-8-19-23(13)15(11)21-12/h7-8,10,17H,2-6,9H2,1H3,(H,18,25)(H,20,21) |
| InChIKey | JHBPRUQQCHODQL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |