C18H20N6O2 — CID 155153457
19-(methylamino)-8-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3(23),4,6,15(22),16,19-heptaen-14-one (PubChem CID 155153457) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 19-(methylamino)-8-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3(23),4,6,15(22),16,19-heptaen-14-one.
| Compound Name | 19-(methylamino)-8-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3(23),4,6,15(22),16,19-heptaen-14-one |
|---|---|
| PubChem CID | 155153457 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 19-(methylamino)-8-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.13,7.018,22]tricosa-1(21),3(23),4,6,15(22),16,19-heptaen-14-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NCCCCOc1cccc(c1)N2 |
| InChI | InChI=1S/C18H20N6O2/c1-19-16-10-15-22-12-5-4-6-13(9-12)26-8-3-2-7-20-18(25)14-11-21-24(16)17(14)23-15/h4-6,9-11,19H,2-3,7-8H2,1H3,(H,20,25)(H,22,23) |
| InChIKey | RHRYPLVYFDWNHZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |