C17H16N6O2 — CID 155153540
17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaene-8,12-dione (PubChem CID 155153540) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaene-8,12-dione.
| Compound Name | 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaene-8,12-dione |
|---|---|
| PubChem CID | 155153540 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaene-8,12-dione |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NCCC(=O)c1cccc(c1)N2 |
| InChI | InChI=1S/C17H16N6O2/c1-18-15-8-14-21-11-4-2-3-10(7-11)13(24)5-6-19-17(25)12-9-20-23(15)16(12)22-14/h2-4,7-9,18H,5-6H2,1H3,(H,19,25)(H,21,22) |
| InChIKey | YVHXLRVTJBXVRQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |