C17H18N6O — CID 155153565
17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaen-12-one (PubChem CID 155153565) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaen-12-one.
| Compound Name | 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaen-12-one |
|---|---|
| PubChem CID | 155153565 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 17-(methylamino)-2,11,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,5,7(21),13(20),14,17-heptaen-12-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NCCCc1cccc(c1)N2 |
| InChI | InChI=1S/C17H18N6O/c1-18-15-9-14-21-12-6-2-4-11(8-12)5-3-7-19-17(24)13-10-20-23(15)16(13)22-14/h2,4,6,8-10,18H,3,5,7H2,1H3,(H,19,24)(H,21,22) |
| InChIKey | TWNQXFDQQVYTQB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |