C16H16N6O — CID 155153566
16-(methylamino)-2,10,14,15,18-pentazatetracyclo[10.5.2.13,7.015,19]icosa-1(18),3,5,7(20),12(19),13,16-heptaen-11-one (PubChem CID 155153566) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 16-(methylamino)-2,10,14,15,18-pentazatetracyclo[10.5.2.13,7.015,19]icosa-1(18),3,5,7(20),12(19),13,16-heptaen-11-one.
| Compound Name | 16-(methylamino)-2,10,14,15,18-pentazatetracyclo[10.5.2.13,7.015,19]icosa-1(18),3,5,7(20),12(19),13,16-heptaen-11-one |
|---|---|
| PubChem CID | 155153566 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 16-(methylamino)-2,10,14,15,18-pentazatetracyclo[10.5.2.13,7.015,19]icosa-1(18),3,5,7(20),12(19),13,16-heptaen-11-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)NCCc1cccc(c1)N2 |
| InChI | InChI=1S/C16H16N6O/c1-17-14-8-13-20-11-4-2-3-10(7-11)5-6-18-16(23)12-9-19-22(14)15(12)21-13/h2-4,7-9,17H,5-6H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | CBFJKERNYSJJOP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |