C14H8ClF4NO3 — CID 155153836
6-[[3-chloro-4-(trifluoromethyl)phenoxy]methyl]-3-fluoropyridine-2-carboxylic acid (PubChem CID 155153836) has the molecular formula C14H8ClF4NO3 and a molecular weight of 349.67 g/mol. Its IUPAC name is 6-[[3-chloro-4-(trifluoromethyl)phenoxy]methyl]-3-fluoropyridine-2-carboxylic acid.
| Compound Name | 6-[[3-chloro-4-(trifluoromethyl)phenoxy]methyl]-3-fluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155153836 |
| Molecular Formula | C14H8ClF4NO3 |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 6-[[3-chloro-4-(trifluoromethyl)phenoxy]methyl]-3-fluoropyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(COc2ccc(C(F)(F)F)c(Cl)c2)ccc1F |
| InChI | InChI=1S/C14H8ClF4NO3/c15-10-5-8(2-3-9(10)14(17,18)19)23-6-7-1-4-11(16)12(20-7)13(21)22/h1-5H,6H2,(H,21,22) |
| InChIKey | BYQOIHKKNOVWCT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |