C20H30O2 — CID 15515432
4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-5-one (PubChem CID 15515432) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-5-one.
| Compound Name | 4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 15515432 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1=CCOC1=O |
| InChI | InChI=1S/C20H30O2/c1-16(2)8-5-9-17(3)10-6-11-18(4)12-7-13-19-14-15-22-20(19)21/h8,10,12,14H,5-7,9,11,13,15H2,1-4H3/b17-10+,18-12+ |
| InChIKey | HVYUMVJJYINCJI-VZRGJMDUSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|