About 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol
2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol (PubChem CID 155154325) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol |
| PubChem CID | 155154325 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol |
| SMILES | CCNc1cccc(C(O)(O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C13H23N3O2/c1-5-14-11-8-6-7-10(16-11)13(17,18)9-15-12(2,3)4/h6-8,15,17-18H,5,9H2,1-4H3,(H,14,16) |
| InChIKey | FHHXQWTWSNPMIR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol?
The IUPAC name of 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol (CID 155154325) is 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol.
What is the SMILES notation for 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol?
The canonical SMILES for 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol is CCNc1cccc(C(O)(O)CNC(C)(C)C)n1.
What is the InChIKey of 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol?
The InChIKey is FHHXQWTWSNPMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-5-14-11-8-6-7-10(16-11)13(17,18)9-15-12(2,3)4/h6-8,15,17-18H,5,9H2,1-4H3,(H,14,16).
What are the key properties of 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol?
2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol has a molecular weight of 253.35 g/mol, XLogP of 1.04, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-1-[6-(ethylamino)-2-pyridinyl]ethane-1,1-diol is sourced from PubChem (CID 155154325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).