C20H29N — CID 155154681
3,6-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-carbazole (PubChem CID 155154681) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 3,6-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-carbazole.
| Compound Name | 3,6-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-carbazole |
|---|---|
| PubChem CID | 155154681 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 3,6-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-carbazole |
| SMILES | CC(C)(C)C1=CC2C(C=C1)NC1C=CC(C(C)(C)C)=CC12 |
| InChI | InChI=1S/C20H29N/c1-19(2,3)13-7-9-17-15(11-13)16-12-14(20(4,5)6)8-10-18(16)21-17/h7-12,15-18,21H,1-6H3 |
| InChIKey | QLEWAWFEOSJKFC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |