C23H41NO2 — CID 155154771
1-[2-(6,6-dimethyldec-1-en-7-yn-2-yloxy)ethyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 155154771) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is 1-[2-(6,6-dimethyldec-1-en-7-yn-2-yloxy)ethyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[2-(6,6-dimethyldec-1-en-7-yn-2-yloxy)ethyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 155154771 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 1-[2-(6,6-dimethyldec-1-en-7-yn-2-yloxy)ethyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | C=C(CCCC(C)(C)C#CCC)OCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C23H41NO2/c1-9-10-13-21(3,4)14-11-12-19(2)26-16-15-24-22(5,6)17-20(25)18-23(24,7)8/h20,25H,2,9,11-12,14-18H2,1,3-8H3 |
| InChIKey | HVOBZNPZEJTVKF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|