C24H24ClIN4O4S — CID 155154846
N-[5-[[4-[2-[3-chloro-5-cyano-4-(2-iodoethoxy)phenyl]propan-2-yl]phenoxy]methyl]pyrimidin-4-yl]methanesulfonamide (PubChem CID 155154846) has the molecular formula C24H24ClIN4O4S and a molecular weight of 626.90 g/mol. Its IUPAC name is N-[5-[[4-[2-[3-chloro-5-cyano-4-(2-iodoethoxy)phenyl]propan-2-yl]phenoxy]methyl]pyrimidin-4-yl]methanesulfonamide.
| Compound Name | N-[5-[[4-[2-[3-chloro-5-cyano-4-(2-iodoethoxy)phenyl]propan-2-yl]phenoxy]methyl]pyrimidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 155154846 |
| Molecular Formula | C24H24ClIN4O4S |
| Molecular Weight | 626.90 g/mol |
| Exact Mass | 626.03 |
| IUPAC Name | N-[5-[[4-[2-[3-chloro-5-cyano-4-(2-iodoethoxy)phenyl]propan-2-yl]phenoxy]methyl]pyrimidin-4-yl]methanesulfonamide |
| SMILES | CC(C)(c1ccc(OCc2cncnc2NS(C)(=O)=O)cc1)c1cc(Cl)c(OCCI)c(C#N)c1 |
| InChI | InChI=1S/C24H24ClIN4O4S/c1-24(2,19-10-16(12-27)22(21(25)11-19)33-9-8-26)18-4-6-20(7-5-18)34-14-17-13-28-15-29-23(17)30-35(3,31)32/h4-7,10-11,13,15H,8-9,14H2,1-3H3,(H,28,29,30) |
| InChIKey | PUTYDVHNZBQAJH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|