About N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide
N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide (PubChem CID 155155043) has the molecular formula C8H13F2NO2
and a molecular weight of 193.19 g/mol. Its IUPAC name is N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide |
| PubChem CID | 155155043 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1(O)CC(F)(F)C1 |
| InChI | InChI=1S/C8H13F2NO2/c1-6(12)11-3-2-7(13)4-8(9,10)5-7/h13H,2-5H2,1H3,(H,11,12) |
| InChIKey | DKYYARYOVCMQRY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide?
The IUPAC name of N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide (CID 155155043) is N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide.
What is the SMILES notation for N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide?
The canonical SMILES for N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide is CC(=O)NCCC1(O)CC(F)(F)C1.
What is the InChIKey of N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide?
The InChIKey is DKYYARYOVCMQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO2/c1-6(12)11-3-2-7(13)4-8(9,10)5-7/h13H,2-5H2,1H3,(H,11,12).
What are the key properties of N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide?
N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide has a molecular weight of 193.19 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-difluoro-1-hydroxycyclobutyl)ethyl]acetamide is sourced from PubChem (CID 155155043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).