C19H22F3N7O — CID 155155044
1-propyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 155155044) has the molecular formula C19H22F3N7O and a molecular weight of 421.43 g/mol. Its IUPAC name is 1-propyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 1-propyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155155044 |
| Molecular Formula | C19H22F3N7O |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-propyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)NCCC(F)(F)F)c2c1CCN(c1ncnc3[nH]ccc13)C2 |
| InChI | InChI=1S/C19H22F3N7O/c1-2-8-29-14-4-9-28(17-12-3-6-23-16(12)25-11-26-17)10-13(14)15(27-29)18(30)24-7-5-19(20,21)22/h3,6,11H,2,4-5,7-10H2,1H3,(H,24,30)(H,23,25,26) |
| InChIKey | KCEYTKLXZWHBRD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |