C17H17F3N6O3 — CID 155155054
5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(4,4,4-trifluoro-1-hydroxybutan-2-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide (PubChem CID 155155054) has the molecular formula C17H17F3N6O3 and a molecular weight of 410.36 g/mol. Its IUPAC name is 5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(4,4,4-trifluoro-1-hydroxybutan-2-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide.
| Compound Name | 5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(4,4,4-trifluoro-1-hydroxybutan-2-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155155054 |
| Molecular Formula | C17H17F3N6O3 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(4,4,4-trifluoro-1-hydroxybutan-2-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
| SMILES | O=C(NC(CO)CC(F)(F)F)c1noc2c1CN(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C17H17F3N6O3/c18-17(19,20)5-9(7-27)24-16(28)13-11-6-26(4-2-12(11)29-25-13)15-10-1-3-21-14(10)22-8-23-15/h1,3,8-9,27H,2,4-7H2,(H,24,28)(H,21,22,23) |
| InChIKey | PXGZGPLNLWQZCC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |