C17H17F3N6O — CID 155155055
6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine-1-carboxamide (PubChem CID 155155055) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is 6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine-1-carboxamide.
| Compound Name | 6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 155155055 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine-1-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)n1ccc2c1CN(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C17H17F3N6O/c18-17(19,20)4-6-22-16(27)26-8-3-11-2-7-25(9-13(11)26)15-12-1-5-21-14(12)23-10-24-15/h1,3,5,8,10H,2,4,6-7,9H2,(H,22,27)(H,21,23,24) |
| InChIKey | MJBODQMRGIDADM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |