C18H18F2N6O2 — CID 155155100
N-[(3,3-difluorocyclobutyl)methyl]-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide (PubChem CID 155155100) has the molecular formula C18H18F2N6O2 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide.
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155155100 |
| Molecular Formula | C18H18F2N6O2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CC(F)(F)C1)c1noc2c1CN(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C18H18F2N6O2/c19-18(20)5-10(6-18)7-22-17(27)14-12-8-26(4-2-13(12)28-25-14)16-11-1-3-21-15(11)23-9-24-16/h1,3,9-10H,2,4-8H2,(H,22,27)(H,21,23,24) |
| InChIKey | RZOKQTAGBJSOSB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |