C24H21F5N2O4S — CID 155155590
4-[[(2,3,4,5,6-pentafluorophenyl)sulfonyl-propylamino]methyl]-N-phenylmethoxybenzamide (PubChem CID 155155590) has the molecular formula C24H21F5N2O4S and a molecular weight of 528.50 g/mol. Its IUPAC name is 4-[[(2,3,4,5,6-pentafluorophenyl)sulfonyl-propylamino]methyl]-N-phenylmethoxybenzamide.
| Compound Name | 4-[[(2,3,4,5,6-pentafluorophenyl)sulfonyl-propylamino]methyl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 155155590 |
| Molecular Formula | C24H21F5N2O4S |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 4-[[(2,3,4,5,6-pentafluorophenyl)sulfonyl-propylamino]methyl]-N-phenylmethoxybenzamide |
| SMILES | CCCN(Cc1ccc(C(=O)NOCc2ccccc2)cc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H21F5N2O4S/c1-2-12-31(36(33,34)23-21(28)19(26)18(25)20(27)22(23)29)13-15-8-10-17(11-9-15)24(32)30-35-14-16-6-4-3-5-7-16/h3-11H,2,12-14H2,1H3,(H,30,32) |
| InChIKey | ICKILJIZWSUBRO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|