About (4S)-4-ethylazepan-4-ol
(4S)-4-ethylazepan-4-ol (PubChem CID 155155678) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is (4S)-4-ethylazepan-4-ol.
Molecular Properties
| Compound Name | (4S)-4-ethylazepan-4-ol |
| PubChem CID | 155155678 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (4S)-4-ethylazepan-4-ol |
| SMILES | CC[C@]1(O)CCCNCC1 |
| InChI | InChI=1S/C8H17NO/c1-2-8(10)4-3-6-9-7-5-8/h9-10H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | OZBPJXGMOOMNGE-QMMMGPOBSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-ethylazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-ethylazepan-4-ol?
The IUPAC name of (4S)-4-ethylazepan-4-ol (CID 155155678) is (4S)-4-ethylazepan-4-ol.
What is the SMILES notation for (4S)-4-ethylazepan-4-ol?
The canonical SMILES for (4S)-4-ethylazepan-4-ol is CC[C@]1(O)CCCNCC1.
What is the InChIKey of (4S)-4-ethylazepan-4-ol?
The InChIKey is OZBPJXGMOOMNGE-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-8(10)4-3-6-9-7-5-8/h9-10H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of (4S)-4-ethylazepan-4-ol?
(4S)-4-ethylazepan-4-ol has a molecular weight of 143.23 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-ethylazepan-4-ol is sourced from PubChem (CID 155155678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).