About 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine
5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine (PubChem CID 155155727) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine.
Molecular Properties
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine |
| PubChem CID | 155155727 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine |
| SMILES | C1=CC(C2C=NC=NC2)=CCC1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h2,4-6,8,10H,1,3,7H2 |
| InChIKey | PASDPSMMOUSTDN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine?
The IUPAC name of 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine (CID 155155727) is 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine.
What is the SMILES notation for 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine?
The canonical SMILES for 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine is C1=CC(C2C=NC=NC2)=CCC1.
What is the InChIKey of 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine?
The InChIKey is PASDPSMMOUSTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h2,4-6,8,10H,1,3,7H2.
What are the key properties of 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine?
5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine has a molecular weight of 160.22 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,5-dien-1-yl-4,5-dihydropyrimidine is sourced from PubChem (CID 155155727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).