C22H19F5N2O4S — CID 155155744
2,3,4,5-tetrafluoro-N-[(2-fluoro-4-methylphenyl)methyl]-N-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]benzenesulfonamide (PubChem CID 155155744) has the molecular formula C22H19F5N2O4S and a molecular weight of 502.46 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[(2-fluoro-4-methylphenyl)methyl]-N-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[(2-fluoro-4-methylphenyl)methyl]-N-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155155744 |
| Molecular Formula | C22H19F5N2O4S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[(2-fluoro-4-methylphenyl)methyl]-N-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CN(Cc2ccc(C(O)NO)cc2)S(=O)(=O)c2cc(F)c(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C22H19F5N2O4S/c1-12-2-5-15(16(23)8-12)11-29(10-13-3-6-14(7-4-13)22(30)28-31)34(32,33)18-9-17(24)19(25)21(27)20(18)26/h2-9,22,28,30-31H,10-11H2,1H3 |
| InChIKey | FPAXAQCWYKYNPQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|