C18H13F5N2O3 — CID 155155879
N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]benzamide (PubChem CID 155155879) has the molecular formula C18H13F5N2O3 and a molecular weight of 400.30 g/mol. Its IUPAC name is N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]benzamide.
| Compound Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 155155879 |
| Molecular Formula | C18H13F5N2O3 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CN(C(=O)c2c(F)c(F)c(F)c(F)c2F)C2CC2)cc1 |
| InChI | InChI=1S/C18H13F5N2O3/c19-12-11(13(20)15(22)16(23)14(12)21)18(27)25(10-5-6-10)7-8-1-3-9(4-2-8)17(26)24-28/h1-4,10,28H,5-7H2,(H,24,26) |
| InChIKey | PLCGUTJDXRIBKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|