About S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate
S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate (PubChem CID 155155991) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate.
Molecular Properties
| Compound Name | S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate |
| PubChem CID | 155155991 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate |
| SMILES | CCCCC1CCC(CC(=O)SCC)OO1 |
| InChI | InChI=1S/C12H22O3S/c1-3-5-6-10-7-8-11(15-14-10)9-12(13)16-4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | BMWHCDNJTVPPIX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate?
The IUPAC name of S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate (CID 155155991) is S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate.
What is the SMILES notation for S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate?
The canonical SMILES for S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate is CCCCC1CCC(CC(=O)SCC)OO1.
What is the InChIKey of S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate?
The InChIKey is BMWHCDNJTVPPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c1-3-5-6-10-7-8-11(15-14-10)9-12(13)16-4-2/h10-11H,3-9H2,1-2H3.
What are the key properties of S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate?
S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate has a molecular weight of 246.37 g/mol, XLogP of 3.33, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2-(6-butyldioxan-3-yl)ethanethioate is sourced from PubChem (CID 155155991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).