C44H54N2O9 — CID 155156367
[2,2-bis[(2-cyanoacetyl)oxymethyl]-3-[4-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxy)phenoxy]propyl] 2-methylprop-2-enoate (PubChem CID 155156367) has the molecular formula C44H54N2O9 and a molecular weight of 754.92 g/mol. Its IUPAC name is [2,2-bis[(2-cyanoacetyl)oxymethyl]-3-[4-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxy)phenoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-bis[(2-cyanoacetyl)oxymethyl]-3-[4-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxy)phenoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155156367 |
| Molecular Formula | C44H54N2O9 |
| Molecular Weight | 754.92 g/mol |
| Exact Mass | 754.38 |
| IUPAC Name | [2,2-bis[(2-cyanoacetyl)oxymethyl]-3-[4-[2-ethyl-4-(4-pentylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxy)phenoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)CC#N)(COC(=O)CC#N)COc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2CC)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C44H54N2O9/c1-7-9-10-11-32-12-14-34(15-13-32)35-16-18-37(33(8-2)24-35)36-17-19-38(39(25-36)55-43(50)31(5)6)51-26-44(27-52-40(47)20-22-45,28-53-41(48)21-23-46)29-54-42(49)30(3)4/h16-19,24-25,32,34H,3,5,7-15,20-21,26-29H2,1-2,4,6H3 |
| InChIKey | FXEVEIVFVGLZQA-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 162.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.92 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|