C23H25NO8S — CID 15515663
3-O-ethyl 7-O,8-O-dimethyl 2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3,7,8-tricarboxylate (PubChem CID 15515663) has the molecular formula C23H25NO8S and a molecular weight of 475.52 g/mol. Its IUPAC name is 3-O-ethyl 7-O,8-O-dimethyl 2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3,7,8-tricarboxylate.
| Compound Name | 3-O-ethyl 7-O,8-O-dimethyl 2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3,7,8-tricarboxylate |
|---|---|
| PubChem CID | 15515663 |
| Molecular Formula | C23H25NO8S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 3-O-ethyl 7-O,8-O-dimethyl 2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinoline-3,7,8-tricarboxylate |
| SMILES | CCOC(=O)C1Cc2ccc(C(=O)OC)c(C(=O)OC)c2CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO8S/c1-5-32-22(26)19-12-15-8-11-17(21(25)30-3)20(23(27)31-4)18(15)13-24(19)33(28,29)16-9-6-14(2)7-10-16/h6-11,19H,5,12-13H2,1-4H3 |
| InChIKey | APWXWFNWCOGMMI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|