About (9R)-9-fluoro-4-methylidenedecane-2,5-diimine
(9R)-9-fluoro-4-methylidenedecane-2,5-diimine (PubChem CID 155158151) has the molecular formula C11H19FN2
and a molecular weight of 198.28 g/mol. Its IUPAC name is (9R)-9-fluoro-4-methylidenedecane-2,5-diimine.
Molecular Properties
| Compound Name | (9R)-9-fluoro-4-methylidenedecane-2,5-diimine |
| PubChem CID | 155158151 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (9R)-9-fluoro-4-methylidenedecane-2,5-diimine |
| SMILES | [H]/N=C(\C)CC(=C)/C(CCC[C@@H](C)F)=N/[H] |
| InChI | InChI=1S/C11H19FN2/c1-8(7-10(3)13)11(14)6-4-5-9(2)12/h9,13-14H,1,4-7H2,2-3H3/b13-10+,14-11+/t9-/m1/s1 |
| InChIKey | PZBVRHNVPURVED-SNCRNMCMSA-N |
| XLogP | 3.52 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (9R)-9-fluoro-4-methylidenedecane-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-9-fluoro-4-methylidenedecane-2,5-diimine?
The IUPAC name of (9R)-9-fluoro-4-methylidenedecane-2,5-diimine (CID 155158151) is (9R)-9-fluoro-4-methylidenedecane-2,5-diimine.
What is the SMILES notation for (9R)-9-fluoro-4-methylidenedecane-2,5-diimine?
The canonical SMILES for (9R)-9-fluoro-4-methylidenedecane-2,5-diimine is [H]/N=C(\C)CC(=C)/C(CCC[C@@H](C)F)=N/[H].
What is the InChIKey of (9R)-9-fluoro-4-methylidenedecane-2,5-diimine?
The InChIKey is PZBVRHNVPURVED-SNCRNMCMSA-N. The full InChI is InChI=1S/C11H19FN2/c1-8(7-10(3)13)11(14)6-4-5-9(2)12/h9,13-14H,1,4-7H2,2-3H3/b13-10+,14-11+/t9-/m1/s1.
What are the key properties of (9R)-9-fluoro-4-methylidenedecane-2,5-diimine?
(9R)-9-fluoro-4-methylidenedecane-2,5-diimine has a molecular weight of 198.28 g/mol, XLogP of 3.52, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-fluoro-4-methylidenedecane-2,5-diimine is sourced from PubChem (CID 155158151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).