C26H31FN6O3 — CID 155158332
6-fluoro-2-(morpholine-4-carbonyl)-N-[6-[(E)-[(E)-pentylidenehydrazinylidene]methyl]-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 155158332) has the molecular formula C26H31FN6O3 and a molecular weight of 494.57 g/mol. Its IUPAC name is 6-fluoro-2-(morpholine-4-carbonyl)-N-[6-[(E)-[(E)-pentylidenehydrazinylidene]methyl]-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 6-fluoro-2-(morpholine-4-carbonyl)-N-[6-[(E)-[(E)-pentylidenehydrazinylidene]methyl]-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 155158332 |
| Molecular Formula | C26H31FN6O3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 6-fluoro-2-(morpholine-4-carbonyl)-N-[6-[(E)-[(E)-pentylidenehydrazinylidene]methyl]-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CCCC/C=N/N=C/c1cccc(NC(=O)c2cc3c(cc2F)CCN(C(=O)N2CCOCC2)C3)n1 |
| InChI | InChI=1S/C26H31FN6O3/c1-2-3-4-9-28-29-17-21-6-5-7-24(30-21)31-25(34)22-15-20-18-33(10-8-19(20)16-23(22)27)26(35)32-11-13-36-14-12-32/h5-7,9,15-17H,2-4,8,10-14,18H2,1H3,(H,30,31,34)/b28-9+,29-17+ |
| InChIKey | AGOLPUJHTMNWTA-JVSMEDPXSA-N |
| XLogP | 3.88 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|