About 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine
10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine (PubChem CID 155158434) has the molecular formula C13H23FN2
and a molecular weight of 226.34 g/mol. Its IUPAC name is 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine.
Molecular Properties
| Compound Name | 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine |
| PubChem CID | 155158434 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine |
| SMILES | [H]/N=C(\CCCC(C)F)CC(=C)/C(=N/[H])C(C)C |
| InChI | InChI=1S/C13H23FN2/c1-9(2)13(16)10(3)8-12(15)7-5-6-11(4)14/h9,11,15-16H,3,5-8H2,1-2,4H3/b15-12+,16-13+ |
| InChIKey | XRGVEEFVKPLJFM-WSGPNKEYSA-N |
| XLogP | 4.16 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine?
The IUPAC name of 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine (CID 155158434) is 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine.
What is the SMILES notation for 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine?
The canonical SMILES for 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine is [H]/N=C(\CCCC(C)F)CC(=C)/C(=N/[H])C(C)C.
What is the InChIKey of 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine?
The InChIKey is XRGVEEFVKPLJFM-WSGPNKEYSA-N. The full InChI is InChI=1S/C13H23FN2/c1-9(2)13(16)10(3)8-12(15)7-5-6-11(4)14/h9,11,15-16H,3,5-8H2,1-2,4H3/b15-12+,16-13+.
What are the key properties of 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine?
10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine has a molecular weight of 226.34 g/mol, XLogP of 4.16, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-fluoro-2-methyl-4-methylideneundecane-3,6-diimine is sourced from PubChem (CID 155158434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).