C6H8F5NO — CID 155160639
3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-3-ol (PubChem CID 155160639) has the molecular formula C6H8F5NO and a molecular weight of 205.13 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-3-ol.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155160639 |
| Molecular Formula | C6H8F5NO |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-3-ol |
| SMILES | OC1(C(F)(F)C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C6H8F5NO/c7-5(8,6(9,10)11)4(13)1-2-12-3-4/h12-13H,1-3H2 |
| InChIKey | QHJVSBSGQRXXGI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|