C21H24N4O4 — CID 15516067
2-[(2S)-7-(2-anilinoethylcarbamoyl)-4-methyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid (PubChem CID 15516067) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[(2S)-7-(2-anilinoethylcarbamoyl)-4-methyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-7-(2-anilinoethylcarbamoyl)-4-methyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 15516067 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[(2S)-7-(2-anilinoethylcarbamoyl)-4-methyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid |
| SMILES | CN1Cc2cc(C(=O)NCCNc3ccccc3)ccc2N[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C21H24N4O4/c1-25-13-15-11-14(7-8-17(15)24-18(21(25)29)12-19(26)27)20(28)23-10-9-22-16-5-3-2-4-6-16/h2-8,11,18,22,24H,9-10,12-13H2,1H3,(H,23,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | ZIQYUBASERVYOD-SFHVURJKSA-N |
| XLogP | 1.76 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|