About 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole
3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole (PubChem CID 155161016) has the molecular formula C18H34N2O
and a molecular weight of 294.48 g/mol. Its IUPAC name is 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole |
| PubChem CID | 155161016 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole |
| SMILES | CCCCC1(COCC)CCC(C2NNC=C2CC)CC1 |
| InChI | InChI=1S/C18H34N2O/c1-4-7-10-18(14-21-6-3)11-8-16(9-12-18)17-15(5-2)13-19-20-17/h13,16-17,19-20H,4-12,14H2,1-3H3 |
| InChIKey | JKDASERAGTZZMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole?
The IUPAC name of 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole (CID 155161016) is 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole?
The canonical SMILES for 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole is CCCCC1(COCC)CCC(C2NNC=C2CC)CC1.
What is the InChIKey of 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole?
The InChIKey is JKDASERAGTZZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N2O/c1-4-7-10-18(14-21-6-3)11-8-16(9-12-18)17-15(5-2)13-19-20-17/h13,16-17,19-20H,4-12,14H2,1-3H3.
What are the key properties of 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole?
3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole has a molecular weight of 294.48 g/mol, XLogP of 4.16, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-butyl-4-(ethoxymethyl)cyclohexyl]-4-ethyl-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 155161016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).