C38H56O7 — CID 155161423
(1S,2R,3R)-2-[4-(1,3-dioxolan-2-yl)butyl]-4-[(4-methoxyphenyl)methoxy]-3-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]cyclopentan-1-ol (PubChem CID 155161423) has the molecular formula C38H56O7 and a molecular weight of 624.86 g/mol. Its IUPAC name is (1S,2R,3R)-2-[4-(1,3-dioxolan-2-yl)butyl]-4-[(4-methoxyphenyl)methoxy]-3-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,3R)-2-[4-(1,3-dioxolan-2-yl)butyl]-4-[(4-methoxyphenyl)methoxy]-3-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 155161423 |
| Molecular Formula | C38H56O7 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | (1S,2R,3R)-2-[4-(1,3-dioxolan-2-yl)butyl]-4-[(4-methoxyphenyl)methoxy]-3-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]cyclopentan-1-ol |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@H]1C(OCc2ccc(OC)cc2)C[C@H](O)[C@@H]1CCCCC1OCCO1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H56O7/c1-5-6-9-28(2)24-33(44-26-29-12-16-31(40-3)17-13-29)20-21-35-34(10-7-8-11-38-42-22-23-43-38)36(39)25-37(35)45-27-30-14-18-32(41-4)19-15-30/h12-21,28,33-39H,5-11,22-27H2,1-4H3/b21-20+/t28-,33+,34+,35+,36-,37?/m0/s1 |
| InChIKey | BAMQPHBGSRMIDX-DCRZYWKUSA-N |
| XLogP | 7.88 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|