About 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane
9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane (PubChem CID 155161461) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane.
Molecular Properties
| Compound Name | 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane |
| PubChem CID | 155161461 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane |
| SMILES | ON1C2CC3CCC(C2)CC1C3 |
| InChI | InChI=1S/C10H17NO/c12-11-9-3-7-1-2-8(5-9)6-10(11)4-7/h7-10,12H,1-6H2 |
| InChIKey | YSZQOEXKWSAJRP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane?
The IUPAC name of 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane (CID 155161461) is 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane.
What is the SMILES notation for 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane?
The canonical SMILES for 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane is ON1C2CC3CCC(C2)CC1C3.
What is the InChIKey of 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane?
The InChIKey is YSZQOEXKWSAJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c12-11-9-3-7-1-2-8(5-9)6-10(11)4-7/h7-10,12H,1-6H2.
What are the key properties of 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane?
9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane has a molecular weight of 167.25 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-9-azatricyclo[4.3.1.13,8]undecane is sourced from PubChem (CID 155161461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).