C21H41N2O6P — CID 155162110
[(E,3R,4R,5S,6R,9S,10S,12R)-9-amino-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5-dimethyltetradec-1-en-6-yl] phosphanylformate (PubChem CID 155162110) has the molecular formula C21H41N2O6P and a molecular weight of 448.54 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12R)-9-amino-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5-dimethyltetradec-1-en-6-yl] phosphanylformate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12R)-9-amino-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5-dimethyltetradec-1-en-6-yl] phosphanylformate |
|---|---|
| PubChem CID | 155162110 |
| Molecular Formula | C21H41N2O6P |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12R)-9-amino-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5-dimethyltetradec-1-en-6-yl] phosphanylformate |
| SMILES | CC[C@@H](O)C[C@H](OC)[C@@H](N)CC[C@@H](OC(=O)P)[C@H](C)[C@H](OC)[C@H](C)/C=C/N(C)C=O |
| InChI | InChI=1S/C21H41N2O6P/c1-7-16(25)12-19(27-5)17(22)8-9-18(29-21(26)30)15(3)20(28-6)14(2)10-11-23(4)13-24/h10-11,13-20,25H,7-9,12,22,30H2,1-6H3/b11-10+/t14-,15+,16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | WKWJCDVVWGACIA-VAFOLIPOSA-N |
| XLogP | 2.54 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|