C25H41IO6 — CID 155162306
[(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate (PubChem CID 155162306) has the molecular formula C25H41IO6 and a molecular weight of 564.50 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 155162306 |
| Molecular Formula | C25H41IO6 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12S)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate |
| SMILES | CO[C@@H](C[C@H](O)C(C)C)[C@@H](C)CC[C@@H](OC(=O)c1ccco1)C(C)[C@H](OC)[C@H](C)/C=C/I |
| InChI | InChI=1S/C25H41IO6/c1-16(2)20(27)15-23(29-6)17(3)10-11-21(32-25(28)22-9-8-14-31-22)19(5)24(30-7)18(4)12-13-26/h8-9,12-14,16-21,23-24,27H,10-11,15H2,1-7H3/b13-12+/t17-,18+,19?,20-,21+,23-,24+/m0/s1 |
| InChIKey | AIQINYWYJHHDLD-LYMMSMHKSA-N |
| XLogP | 5.88 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|