C25H42N2O7 — CID 155162318
[(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4,12-dihydroxy-10-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate (PubChem CID 155162318) has the molecular formula C25H42N2O7 and a molecular weight of 482.62 g/mol. Its IUPAC name is [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4,12-dihydroxy-10-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate.
| Compound Name | [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4,12-dihydroxy-10-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 155162318 |
| Molecular Formula | C25H42N2O7 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4,12-dihydroxy-10-methoxy-3,5,13-trimethyltetradec-1-en-6-yl] furan-2-carboxylate |
| SMILES | CO[C@@H](C[C@H](O)C(C)C)[C@@H](N)CC[C@@H](OC(=O)c1ccco1)[C@H](C)[C@H](O)[C@H](C)/C=C/N(C)C=O |
| InChI | InChI=1S/C25H42N2O7/c1-16(2)20(29)14-23(32-6)19(26)9-10-21(34-25(31)22-8-7-13-33-22)18(4)24(30)17(3)11-12-27(5)15-28/h7-8,11-13,15-21,23-24,29-30H,9-10,14,26H2,1-6H3/b12-11+/t17-,18+,19+,20+,21-,23+,24-/m1/s1 |
| InChIKey | QFJIBJKCBHPEOG-KNBVPXGQSA-N |
| XLogP | 2.57 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|