C27H45NO7 — CID 155162320
[(E,3R,4R,5S,6R,9S,10S,12S)-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate (PubChem CID 155162320) has the molecular formula C27H45NO7 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12S)-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12S)-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 155162320 |
| Molecular Formula | C27H45NO7 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12S)-1-[formyl(methyl)amino]-12-hydroxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradec-1-en-6-yl] furan-2-carboxylate |
| SMILES | CO[C@@H]([C@@H](C)[C@@H](CC[C@H](C)[C@H](C[C@H](O)C(C)C)OC)OC(=O)c1ccco1)[C@H](C)/C=C/N(C)C=O |
| InChI | InChI=1S/C27H45NO7/c1-18(2)22(30)16-25(32-7)19(3)11-12-23(35-27(31)24-10-9-15-34-24)21(5)26(33-8)20(4)13-14-28(6)17-29/h9-10,13-15,17-23,25-26,30H,11-12,16H2,1-8H3/b14-13+/t19-,20+,21-,22-,23+,25-,26+/m0/s1 |
| InChIKey | GGOCNHRTBHTNHS-GRNRCYQBSA-N |
| XLogP | 4.53 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|